C26H20Cl2F2N2O3 — CID 24788647
(3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(6-ethoxy-2,3-difluorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 24788647) has the molecular formula C26H20Cl2F2N2O3 and a molecular weight of 517.36 g/mol. Its IUPAC name is (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(6-ethoxy-2,3-difluorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(6-ethoxy-2,3-difluorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 24788647 |
| Molecular Formula | C26H20Cl2F2N2O3 |
| Molecular Weight | 517.36 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(6-ethoxy-2,3-difluorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | CCOc1ccc(F)c(F)c1[C@H]1NC(=O)C[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C26H20Cl2F2N2O3/c1-2-35-20-9-8-18(29)23(30)22(20)24-26(16-7-6-15(28)11-19(16)31-25(26)34)17(12-21(33)32-24)13-4-3-5-14(27)10-13/h3-11,17,24H,2,12H2,1H3,(H,31,34)(H,32,33)/t17-,24+,26-/m0/s1 |
| InChIKey | LCGRJCJDPCZBTA-NLRIEGLYSA-N |
| XLogP | 5.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.36 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |