C24H14Br2O4 — CID 24788889
3,3-bis(3-bromo-4-hydroxyphenyl)benzo[g][2]benzofuran-1-one (PubChem CID 24788889) has the molecular formula C24H14Br2O4 and a molecular weight of 526.18 g/mol. Its IUPAC name is 3,3-bis(3-bromo-4-hydroxyphenyl)benzo[g][2]benzofuran-1-one.
| Compound Name | 3,3-bis(3-bromo-4-hydroxyphenyl)benzo[g][2]benzofuran-1-one |
|---|---|
| PubChem CID | 24788889 |
| Molecular Formula | C24H14Br2O4 |
| Molecular Weight | 526.18 g/mol |
| Exact Mass | 523.93 |
| IUPAC Name | 3,3-bis(3-bromo-4-hydroxyphenyl)benzo[g][2]benzofuran-1-one |
| SMILES | O=C1OC(c2ccc(O)c(Br)c2)(c2ccc(O)c(Br)c2)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C24H14Br2O4/c25-18-11-14(6-9-20(18)27)24(15-7-10-21(28)19(26)12-15)17-8-5-13-3-1-2-4-16(13)22(17)23(29)30-24/h1-12,27-28H |
| InChIKey | XDRGUQQUABBMCG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.18 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |