C22H16F3N3O6 — CID 24788913
N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 24788913) has the molecular formula C22H16F3N3O6 and a molecular weight of 475.38 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 24788913 |
| Molecular Formula | C22H16F3N3O6 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CNC(=O)c4ccc(OC(F)(F)F)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H16F3N3O6/c23-22(24,25)34-13-4-2-12(3-5-13)18(30)26-10-11-1-6-14-15(9-11)21(33)28(20(14)32)16-7-8-17(29)27-19(16)31/h1-6,9,16H,7-8,10H2,(H,26,30)(H,27,29,31) |
| InChIKey | JFBUADCBCGPBTM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|