C27H36N2O3 — CID 24789327
N-[(4-methoxyphenyl)methyl]-2-[(3R,4R)-2-oxo-4-pentyl-1-(2-phenylethyl)pyrrolidin-3-yl]acetamide (PubChem CID 24789327) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-[(3R,4R)-2-oxo-4-pentyl-1-(2-phenylethyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-[(3R,4R)-2-oxo-4-pentyl-1-(2-phenylethyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 24789327 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-[(3R,4R)-2-oxo-4-pentyl-1-(2-phenylethyl)pyrrolidin-3-yl]acetamide |
| SMILES | CCCCC[C@H]1CN(CCc2ccccc2)C(=O)[C@@H]1CC(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H36N2O3/c1-3-4-6-11-23-20-29(17-16-21-9-7-5-8-10-21)27(31)25(23)18-26(30)28-19-22-12-14-24(32-2)15-13-22/h5,7-10,12-15,23,25H,3-4,6,11,16-20H2,1-2H3,(H,28,30)/t23-,25+/m0/s1 |
| InChIKey | CNGDVUAVYSLTQK-UKILVPOCSA-N |
| XLogP | 4.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|