C18H27NO3S — CID 24789355
(6S)-5-benzyl-6-(cyclohexylmethyl)-1,4,5-oxathiazepane 4,4-dioxide (PubChem CID 24789355) has the molecular formula C18H27NO3S and a molecular weight of 337.48 g/mol. Its IUPAC name is (6S)-5-benzyl-6-(cyclohexylmethyl)-1,4,5-oxathiazepane 4,4-dioxide.
| Compound Name | (6S)-5-benzyl-6-(cyclohexylmethyl)-1,4,5-oxathiazepane 4,4-dioxide |
|---|---|
| PubChem CID | 24789355 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (6S)-5-benzyl-6-(cyclohexylmethyl)-1,4,5-oxathiazepane 4,4-dioxide |
| SMILES | O=S1(=O)CCOC[C@H](CC2CCCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H27NO3S/c20-23(21)12-11-22-15-18(13-16-7-3-1-4-8-16)19(23)14-17-9-5-2-6-10-17/h2,5-6,9-10,16,18H,1,3-4,7-8,11-15H2/t18-/m0/s1 |
| InChIKey | KHQWRZUVDOLSIW-SFHVURJKSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |