C23H29NOS — CID 24789375
(5S)-5-methyl-1-[(2S)-1-(4-methylphenyl)sulfanyl-3-phenylpropan-2-yl]azepan-2-one (PubChem CID 24789375) has the molecular formula C23H29NOS and a molecular weight of 367.56 g/mol. Its IUPAC name is (5S)-5-methyl-1-[(2S)-1-(4-methylphenyl)sulfanyl-3-phenylpropan-2-yl]azepan-2-one.
| Compound Name | (5S)-5-methyl-1-[(2S)-1-(4-methylphenyl)sulfanyl-3-phenylpropan-2-yl]azepan-2-one |
|---|---|
| PubChem CID | 24789375 |
| Molecular Formula | C23H29NOS |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (5S)-5-methyl-1-[(2S)-1-(4-methylphenyl)sulfanyl-3-phenylpropan-2-yl]azepan-2-one |
| SMILES | Cc1ccc(SCC(Cc2ccccc2)N2CC[C@@H](C)CCC2=O)cc1 |
| InChI | InChI=1S/C23H29NOS/c1-18-8-11-22(12-9-18)26-17-21(16-20-6-4-3-5-7-20)24-15-14-19(2)10-13-23(24)25/h3-9,11-12,19,21H,10,13-17H2,1-2H3/t19-,21?/m0/s1 |
| InChIKey | MLURRNSCNXOXAM-ZQRQZVKFSA-N |
| XLogP | 5.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |