C23H24N2O5 — CID 24789447
ethyl 4-[[3-oxo-2-(oxolan-2-ylmethyl)-1H-isoindole-4-carbonyl]amino]benzoate (PubChem CID 24789447) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is ethyl 4-[[3-oxo-2-(oxolan-2-ylmethyl)-1H-isoindole-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-oxo-2-(oxolan-2-ylmethyl)-1H-isoindole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 24789447 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl 4-[[3-oxo-2-(oxolan-2-ylmethyl)-1H-isoindole-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cccc3c2C(=O)N(CC2CCCO2)C3)cc1 |
| InChI | InChI=1S/C23H24N2O5/c1-2-29-23(28)15-8-10-17(11-9-15)24-21(26)19-7-3-5-16-13-25(22(27)20(16)19)14-18-6-4-12-30-18/h3,5,7-11,18H,2,4,6,12-14H2,1H3,(H,24,26) |
| InChIKey | PKGKHNCOCOQXSJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |