C22H27NO2 — CID 24789456
(5S)-5-methyl-1-[(2S)-1-phenoxy-3-phenylpropan-2-yl]azepan-2-one (PubChem CID 24789456) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (5S)-5-methyl-1-[(2S)-1-phenoxy-3-phenylpropan-2-yl]azepan-2-one.
| Compound Name | (5S)-5-methyl-1-[(2S)-1-phenoxy-3-phenylpropan-2-yl]azepan-2-one |
|---|---|
| PubChem CID | 24789456 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (5S)-5-methyl-1-[(2S)-1-phenoxy-3-phenylpropan-2-yl]azepan-2-one |
| SMILES | C[C@H]1CCC(=O)N([C@H](COc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27NO2/c1-18-12-13-22(24)23(15-14-18)20(16-19-8-4-2-5-9-19)17-25-21-10-6-3-7-11-21/h2-11,18,20H,12-17H2,1H3/t18-,20-/m0/s1 |
| InChIKey | PHVHKJIQGLBSMI-ICSRJNTNSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |