About (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone
(4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 24789614) has the molecular formula C23H20N4O4
and a molecular weight of 416.44 g/mol. Its IUPAC name is (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| PubChem CID | 24789614 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1nc2ccccc2c2oc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cc12 |
| InChI | InChI=1S/C23H20N4O4/c1-15-19-14-21(31-22(19)18-4-2-3-5-20(18)24-15)23(28)26-12-10-25(11-13-26)16-6-8-17(9-7-16)27(29)30/h2-9,14H,10-13H2,1H3 |
| InChIKey | CFUAWBWDTLDWQQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone?
The IUPAC name of (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone (CID 24789614) is (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
What is the SMILES notation for (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone?
The canonical SMILES for (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone is Cc1nc2ccccc2c2oc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cc12.
What is the InChIKey of (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone?
The InChIKey is CFUAWBWDTLDWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O4/c1-15-19-14-21(31-22(19)18-4-2-3-5-20(18)24-15)23(28)26-12-10-25(11-13-26)16-6-8-17(9-7-16)27(29)30/h2-9,14H,10-13H2,1H3.
What are the key properties of (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone?
(4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone has a molecular weight of 416.44 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylfuro[3,2-c]quinolin-2-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone is sourced from PubChem (CID 24789614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).