C21H18ClN3S2 — CID 24789686
5-(4-methylsulfanylphenyl)-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride (PubChem CID 24789686) has the molecular formula C21H18ClN3S2 and a molecular weight of 411.98 g/mol. Its IUPAC name is 5-(4-methylsulfanylphenyl)-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride.
| Compound Name | 5-(4-methylsulfanylphenyl)-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride |
|---|---|
| PubChem CID | 24789686 |
| Molecular Formula | C21H18ClN3S2 |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 5-(4-methylsulfanylphenyl)-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride |
| SMILES | CSc1ccc(-c2sc(Nc3ccccc3)n[n+]2-c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C21H18N3S2.ClH/c1-25-19-14-12-16(13-15-19)20-24(18-10-6-3-7-11-18)23-21(26-20)22-17-8-4-2-5-9-17;/h2-15H,1H3,(H,22,23);1H/q+1;/p-1 |
| InChIKey | MFXBSJCZJNBVBS-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 28.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|