C23H21BrN2O5 — CID 24790014
ethyl (1R,10R,11R,12R)-4-bromo-12-methyl-13,15-dioxo-14-phenyl-8-oxa-14,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2(7),3,5-triene-11-carboxylate (PubChem CID 24790014) has the molecular formula C23H21BrN2O5 and a molecular weight of 485.33 g/mol. Its IUPAC name is ethyl (1R,10R,11R,12R)-4-bromo-12-methyl-13,15-dioxo-14-phenyl-8-oxa-14,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2(7),3,5-triene-11-carboxylate.
| Compound Name | ethyl (1R,10R,11R,12R)-4-bromo-12-methyl-13,15-dioxo-14-phenyl-8-oxa-14,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 24790014 |
| Molecular Formula | C23H21BrN2O5 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | ethyl (1R,10R,11R,12R)-4-bromo-12-methyl-13,15-dioxo-14-phenyl-8-oxa-14,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2(7),3,5-triene-11-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2COc3ccc(Br)cc3[C@@H]2N2C(=O)N(c3ccccc3)C(=O)[C@@]12C |
| InChI | InChI=1S/C23H21BrN2O5/c1-3-30-20(27)18-16-12-31-17-10-9-13(24)11-15(17)19(16)26-22(29)25(21(28)23(18,26)2)14-7-5-4-6-8-14/h4-11,16,18-19H,3,12H2,1-2H3/t16-,18+,19+,23-/m1/s1 |
| InChIKey | XDELYZXWAKZBIT-ZQDYSYBYSA-N |
| XLogP | 3.92 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|