C22H19N3O4 — CID 24790044
(11R,12S,16R,17S)-14-methyl-17-(4-methylphenyl)-1,9,14-triazatetracyclo[9.6.0.03,8.012,16]heptadeca-3,5,7-triene-2,10,13,15-tetrone (PubChem CID 24790044) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is (11R,12S,16R,17S)-14-methyl-17-(4-methylphenyl)-1,9,14-triazatetracyclo[9.6.0.03,8.012,16]heptadeca-3,5,7-triene-2,10,13,15-tetrone.
| Compound Name | (11R,12S,16R,17S)-14-methyl-17-(4-methylphenyl)-1,9,14-triazatetracyclo[9.6.0.03,8.012,16]heptadeca-3,5,7-triene-2,10,13,15-tetrone |
|---|---|
| PubChem CID | 24790044 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (11R,12S,16R,17S)-14-methyl-17-(4-methylphenyl)-1,9,14-triazatetracyclo[9.6.0.03,8.012,16]heptadeca-3,5,7-triene-2,10,13,15-tetrone |
| SMILES | Cc1ccc([C@@H]2[C@@H]3C(=O)N(C)C(=O)[C@@H]3[C@@H]3C(=O)Nc4ccccc4C(=O)N23)cc1 |
| InChI | InChI=1S/C22H19N3O4/c1-11-7-9-12(10-8-11)17-15-16(22(29)24(2)21(15)28)18-19(26)23-14-6-4-3-5-13(14)20(27)25(17)18/h3-10,15-18H,1-2H3,(H,23,26)/t15-,16+,17-,18-/m1/s1 |
| InChIKey | RMDFEHAKFSQCOX-XMTFNYHQSA-N |
| XLogP | 1.74 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|