C25H29N3O4 — CID 24790292
N-[1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,3,4-trimethoxybenzamide (PubChem CID 24790292) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 24790292 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCCc3c2cnn3-c2ccc(C)c(C)c2)c(OC)c1OC |
| InChI | InChI=1S/C25H29N3O4/c1-15-9-10-17(13-16(15)2)28-21-8-6-7-20(19(21)14-26-28)27-25(29)18-11-12-22(30-3)24(32-5)23(18)31-4/h9-14,20H,6-8H2,1-5H3,(H,27,29) |
| InChIKey | BNWGKOSUNZTYGB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |