C34H31ClFN3O4 — CID 24790387
(1S,2R,7S,8R)-2-[(4-chlorophenyl)methyl]-10-cyclohexyl-7-(4-fluorophenyl)-4-(3-methylphenyl)-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone (PubChem CID 24790387) has the molecular formula C34H31ClFN3O4 and a molecular weight of 600.09 g/mol. Its IUPAC name is (1S,2R,7S,8R)-2-[(4-chlorophenyl)methyl]-10-cyclohexyl-7-(4-fluorophenyl)-4-(3-methylphenyl)-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone.
| Compound Name | (1S,2R,7S,8R)-2-[(4-chlorophenyl)methyl]-10-cyclohexyl-7-(4-fluorophenyl)-4-(3-methylphenyl)-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 24790387 |
| Molecular Formula | C34H31ClFN3O4 |
| Molecular Weight | 600.09 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | (1S,2R,7S,8R)-2-[(4-chlorophenyl)methyl]-10-cyclohexyl-7-(4-fluorophenyl)-4-(3-methylphenyl)-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone |
| SMILES | Cc1cccc(N2C(=O)N3[C@H](c4ccc(F)cc4)[C@@H]4C(=O)N(C5CCCCC5)C(=O)[C@@H]4[C@]3(Cc3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C34H31ClFN3O4/c1-20-6-5-9-26(18-20)38-32(42)34(19-21-10-14-23(35)15-11-21)28-27(30(40)37(31(28)41)25-7-3-2-4-8-25)29(39(34)33(38)43)22-12-16-24(36)17-13-22/h5-6,9-18,25,27-29H,2-4,7-8,19H2,1H3/t27-,28-,29-,34-/m1/s1 |
| InChIKey | WHYPKKUFMFAAIW-YBLTVNODSA-N |
| XLogP | 6.23 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.09 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|