C25H25N3O4 — CID 24790389
(1S,2R,7S,8R)-2,10-diethyl-7-(4-methylphenyl)-4-phenyl-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone (PubChem CID 24790389) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (1S,2R,7S,8R)-2,10-diethyl-7-(4-methylphenyl)-4-phenyl-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone.
| Compound Name | (1S,2R,7S,8R)-2,10-diethyl-7-(4-methylphenyl)-4-phenyl-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 24790389 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (1S,2R,7S,8R)-2,10-diethyl-7-(4-methylphenyl)-4-phenyl-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(C)cc3)N3C(=O)N(c4ccccc4)C(=O)[C@@]3(CC)[C@H]2C1=O |
| InChI | InChI=1S/C25H25N3O4/c1-4-25-19-18(21(29)26(5-2)22(19)30)20(16-13-11-15(3)12-14-16)28(25)24(32)27(23(25)31)17-9-7-6-8-10-17/h6-14,18-20H,4-5H2,1-3H3/t18-,19-,20-,25-/m1/s1 |
| InChIKey | KHYHLMAVGIEBNE-KYCQWFEFSA-N |
| XLogP | 3.29 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|