C18H24N2O3 — CID 24790508
2-butyl-N-methyl-N-(oxan-4-yl)-1,3-benzoxazole-5-carboxamide (PubChem CID 24790508) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-butyl-N-methyl-N-(oxan-4-yl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-butyl-N-methyl-N-(oxan-4-yl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 24790508 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-butyl-N-methyl-N-(oxan-4-yl)-1,3-benzoxazole-5-carboxamide |
| SMILES | CCCCc1nc2cc(C(=O)N(C)C3CCOCC3)ccc2o1 |
| InChI | InChI=1S/C18H24N2O3/c1-3-4-5-17-19-15-12-13(6-7-16(15)23-17)18(21)20(2)14-8-10-22-11-9-14/h6-7,12,14H,3-5,8-11H2,1-2H3 |
| InChIKey | HEHRXDWCFCTTFG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |