About [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone
[3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone (PubChem CID 24790750) has the molecular formula C22H24N4O
and a molecular weight of 360.46 g/mol. Its IUPAC name is [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone.
Molecular Properties
| Compound Name | [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone |
| PubChem CID | 24790750 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone |
| SMILES | Cc1ccc(NC2CCCN(C(=O)c3ccc4nccnc4c3)C2)cc1C |
| InChI | InChI=1S/C22H24N4O/c1-15-5-7-18(12-16(15)2)25-19-4-3-11-26(14-19)22(27)17-6-8-20-21(13-17)24-10-9-23-20/h5-10,12-13,19,25H,3-4,11,14H2,1-2H3 |
| InChIKey | AHYRJDUPCVTUMY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone?
The IUPAC name of [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone (CID 24790750) is [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone.
What is the SMILES notation for [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone?
The canonical SMILES for [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone is Cc1ccc(NC2CCCN(C(=O)c3ccc4nccnc4c3)C2)cc1C.
What is the InChIKey of [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone?
The InChIKey is AHYRJDUPCVTUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O/c1-15-5-7-18(12-16(15)2)25-19-4-3-11-26(14-19)22(27)17-6-8-20-21(13-17)24-10-9-23-20/h5-10,12-13,19,25H,3-4,11,14H2,1-2H3.
What are the key properties of [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone?
[3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone has a molecular weight of 360.46 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-dimethylanilino)piperidin-1-yl]-quinoxalin-6-ylmethanone is sourced from PubChem (CID 24790750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).