C26H31FN4O2 — CID 24790783
N-[2-[1-[(2-fluoro-5-methoxyphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-4-phenylbutanamide (PubChem CID 24790783) has the molecular formula C26H31FN4O2 and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[2-[1-[(2-fluoro-5-methoxyphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-4-phenylbutanamide.
| Compound Name | N-[2-[1-[(2-fluoro-5-methoxyphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 24790783 |
| Molecular Formula | C26H31FN4O2 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N-[2-[1-[(2-fluoro-5-methoxyphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-4-phenylbutanamide |
| SMILES | COc1ccc(F)c(CN2CCC(n3nccc3NC(=O)CCCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H31FN4O2/c1-33-23-10-11-24(27)21(18-23)19-30-16-13-22(14-17-30)31-25(12-15-28-31)29-26(32)9-5-8-20-6-3-2-4-7-20/h2-4,6-7,10-12,15,18,22H,5,8-9,13-14,16-17,19H2,1H3,(H,29,32) |
| InChIKey | HOPDUETVDUAJNS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |