About 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone
1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone (PubChem CID 24790849) has the molecular formula C16H18F2N4O
and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone.
Molecular Properties
| Compound Name | 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone |
| PubChem CID | 24790849 |
| Molecular Formula | C16H18F2N4O |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone |
| SMILES | O=C(Cn1cccn1)N1CCCC(Nc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C16H18F2N4O/c17-14-5-4-12(9-15(14)18)20-13-3-1-7-21(10-13)16(23)11-22-8-2-6-19-22/h2,4-6,8-9,13,20H,1,3,7,10-11H2 |
| InChIKey | NGURGWSGLCJUBA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone?
The IUPAC name of 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone (CID 24790849) is 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone.
What is the SMILES notation for 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone?
The canonical SMILES for 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone is O=C(Cn1cccn1)N1CCCC(Nc2ccc(F)c(F)c2)C1.
What is the InChIKey of 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone?
The InChIKey is NGURGWSGLCJUBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2N4O/c17-14-5-4-12(9-15(14)18)20-13-3-1-7-21(10-13)16(23)11-22-8-2-6-19-22/h2,4-6,8-9,13,20H,1,3,7,10-11H2.
What are the key properties of 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone?
1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone has a molecular weight of 320.34 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,4-difluoroanilino)piperidin-1-yl]-2-pyrazol-1-ylethanone is sourced from PubChem (CID 24790849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).