C21H25N3O3 — CID 24790899
[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-[5-[(6-methyl-3-pyridinyl)oxymethyl]-1,2-oxazol-3-yl]methanone (PubChem CID 24790899) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is [2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-[5-[(6-methyl-3-pyridinyl)oxymethyl]-1,2-oxazol-3-yl]methanone.
| Compound Name | [2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-[5-[(6-methyl-3-pyridinyl)oxymethyl]-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 24790899 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-[5-[(6-methyl-3-pyridinyl)oxymethyl]-1,2-oxazol-3-yl]methanone |
| SMILES | C=CCC1(CC=C)CCCN1C(=O)c1cc(COc2ccc(C)nc2)on1 |
| InChI | InChI=1S/C21H25N3O3/c1-4-9-21(10-5-2)11-6-12-24(21)20(25)19-13-18(27-23-19)15-26-17-8-7-16(3)22-14-17/h4-5,7-8,13-14H,1-2,6,9-12,15H2,3H3 |
| InChIKey | YZXOSUCMHURRLO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|