C20H23FN2O — CID 24791061
1-[3-(4-fluoroanilino)piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 24791061) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-[3-(4-fluoroanilino)piperidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[3-(4-fluoroanilino)piperidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 24791061 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-[3-(4-fluoroanilino)piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCCC(Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H23FN2O/c21-17-9-11-18(12-10-17)22-19-7-4-14-23(15-19)20(24)13-8-16-5-2-1-3-6-16/h1-3,5-6,9-12,19,22H,4,7-8,13-15H2 |
| InChIKey | NYLVHYYPTZQWLP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |