About N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide
N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide (PubChem CID 24791072) has the molecular formula C26H32N4O2
and a molecular weight of 432.57 g/mol. Its IUPAC name is N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide.
Molecular Properties
| Compound Name | N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide |
| PubChem CID | 24791072 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide |
| SMILES | Cc1ccc(CN2CCC(n3nccc3NC(=O)CCOc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C26H32N4O2/c1-20-8-9-22(18-21(20)2)19-29-15-11-23(12-16-29)30-25(10-14-27-30)28-26(31)13-17-32-24-6-4-3-5-7-24/h3-10,14,18,23H,11-13,15-17,19H2,1-2H3,(H,28,31) |
| InChIKey | YNRWNRDWYZXDEW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide?
The IUPAC name of N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide (CID 24791072) is N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide.
What is the SMILES notation for N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide?
The canonical SMILES for N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide is Cc1ccc(CN2CCC(n3nccc3NC(=O)CCOc3ccccc3)CC2)cc1C.
What is the InChIKey of N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide?
The InChIKey is YNRWNRDWYZXDEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N4O2/c1-20-8-9-22(18-21(20)2)19-29-15-11-23(12-16-29)30-25(10-14-27-30)28-26(31)13-17-32-24-6-4-3-5-7-24/h3-10,14,18,23H,11-13,15-17,19H2,1-2H3,(H,28,31).
What are the key properties of N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide?
N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide has a molecular weight of 432.57 g/mol, XLogP of 4.74, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]pyrazol-3-yl]-3-phenoxypropanamide is sourced from PubChem (CID 24791072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).