About (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone
(4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone (PubChem CID 24791309) has the molecular formula C18H24N4O2
and a molecular weight of 328.42 g/mol. Its IUPAC name is (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone |
| PubChem CID | 24791309 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone |
| SMILES | Cc1nonc1C(=O)N1CCCC(Nc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C18H24N4O2/c1-12(2)14-6-8-15(9-7-14)19-16-5-4-10-22(11-16)18(23)17-13(3)20-24-21-17/h6-9,12,16,19H,4-5,10-11H2,1-3H3 |
| InChIKey | SMBFJXLFNSYFMQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone?
The IUPAC name of (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone (CID 24791309) is (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone.
What is the SMILES notation for (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone?
The canonical SMILES for (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone is Cc1nonc1C(=O)N1CCCC(Nc2ccc(C(C)C)cc2)C1.
What is the InChIKey of (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone?
The InChIKey is SMBFJXLFNSYFMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2/c1-12(2)14-6-8-15(9-7-14)19-16-5-4-10-22(11-16)18(23)17-13(3)20-24-21-17/h6-9,12,16,19H,4-5,10-11H2,1-3H3.
What are the key properties of (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone?
(4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone has a molecular weight of 328.42 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,2,5-oxadiazol-3-yl)-[3-(4-propan-2-ylanilino)piperidin-1-yl]methanone is sourced from PubChem (CID 24791309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).