C21H26N4O4 — CID 24791316
4-methoxy-N-[2-[1-(oxolane-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]benzamide (PubChem CID 24791316) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-methoxy-N-[2-[1-(oxolane-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]benzamide.
| Compound Name | 4-methoxy-N-[2-[1-(oxolane-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 24791316 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-methoxy-N-[2-[1-(oxolane-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccnn2C2CCN(C(=O)C3CCOC3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O4/c1-28-18-4-2-15(3-5-18)20(26)23-19-6-10-22-25(19)17-7-11-24(12-8-17)21(27)16-9-13-29-14-16/h2-6,10,16-17H,7-9,11-14H2,1H3,(H,23,26) |
| InChIKey | QNWOYGNLPATUDL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |