About 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide
5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide (PubChem CID 24791354) has the molecular formula C19H17F2N3O3
and a molecular weight of 373.36 g/mol. Its IUPAC name is 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 24791354 |
| Molecular Formula | C19H17F2N3O3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CN(CCc1ccccn1)C(=O)c1cc(COc2ccc(F)cc2F)on1 |
| InChI | InChI=1S/C19H17F2N3O3/c1-24(9-7-14-4-2-3-8-22-14)19(25)17-11-15(27-23-17)12-26-18-6-5-13(20)10-16(18)21/h2-6,8,10-11H,7,9,12H2,1H3 |
| InChIKey | ZTEYMKYIEQDAPX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide (CID 24791354) is 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide is CN(CCc1ccccn1)C(=O)c1cc(COc2ccc(F)cc2F)on1.
What is the InChIKey of 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is ZTEYMKYIEQDAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3O3/c1-24(9-7-14-4-2-3-8-22-14)19(25)17-11-15(27-23-17)12-26-18-6-5-13(20)10-16(18)21/h2-6,8,10-11H,7,9,12H2,1H3.
What are the key properties of 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide?
5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 373.36 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-difluorophenoxy)methyl]-N-methyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 24791354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).