C18H15ClN4O2 — CID 24791419
2-chloro-N-(11-oxo-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-2-yl)pyridine-3-carboxamide (PubChem CID 24791419) has the molecular formula C18H15ClN4O2 and a molecular weight of 354.80 g/mol. Its IUPAC name is 2-chloro-N-(11-oxo-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(11-oxo-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24791419 |
| Molecular Formula | C18H15ClN4O2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-chloro-N-(11-oxo-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2nc3n(c(=O)c2c1)CCCC3)c1cccnc1Cl |
| InChI | InChI=1S/C18H15ClN4O2/c19-16-12(4-3-8-20-16)17(24)21-11-6-7-14-13(10-11)18(25)23-9-2-1-5-15(23)22-14/h3-4,6-8,10H,1-2,5,9H2,(H,21,24) |
| InChIKey | FATWFDKDTSYLGB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|