C20H28FN3O4 — CID 24791533
N-[2-(4-fluorophenoxy)ethyl]-1-(2-morpholin-4-ylethyl)-6-oxopiperidine-3-carboxamide (PubChem CID 24791533) has the molecular formula C20H28FN3O4 and a molecular weight of 393.46 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-1-(2-morpholin-4-ylethyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-1-(2-morpholin-4-ylethyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 24791533 |
| Molecular Formula | C20H28FN3O4 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-1-(2-morpholin-4-ylethyl)-6-oxopiperidine-3-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1)C1CCC(=O)N(CCN2CCOCC2)C1 |
| InChI | InChI=1S/C20H28FN3O4/c21-17-2-4-18(5-3-17)28-12-7-22-20(26)16-1-6-19(25)24(15-16)9-8-23-10-13-27-14-11-23/h2-5,16H,1,6-15H2,(H,22,26) |
| InChIKey | MIOOBDVJUITNEK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|