About N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide
N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide (PubChem CID 24791554) has the molecular formula C27H31N5O
and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide.
Molecular Properties
| Compound Name | N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide |
| PubChem CID | 24791554 |
| Molecular Formula | C27H31N5O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccnn1C1CCN(Cc2c(C)n(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C27H31N5O/c1-19-8-4-5-9-22(19)27(33)29-26-12-15-28-32(26)21-13-16-31(17-14-21)18-24-20(2)30(3)25-11-7-6-10-23(24)25/h4-12,15,21H,13-14,16-18H2,1-3H3,(H,29,33) |
| InChIKey | WKVLPSUPYFSSKX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide?
The IUPAC name of N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide (CID 24791554) is N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide.
What is the SMILES notation for N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide?
The canonical SMILES for N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide is Cc1ccccc1C(=O)Nc1ccnn1C1CCN(Cc2c(C)n(C)c3ccccc23)CC1.
What is the InChIKey of N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide?
The InChIKey is WKVLPSUPYFSSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N5O/c1-19-8-4-5-9-22(19)27(33)29-26-12-15-28-32(26)21-13-16-31(17-14-21)18-24-20(2)30(3)25-11-7-6-10-23(24)25/h4-12,15,21H,13-14,16-18H2,1-3H3,(H,29,33).
What are the key properties of N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide?
N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide has a molecular weight of 441.58 g/mol, XLogP of 5.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-[(1,2-dimethylindol-3-yl)methyl]piperidin-4-yl]pyrazol-3-yl]-2-methylbenzamide is sourced from PubChem (CID 24791554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).