About N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide
N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 24791723) has the molecular formula C19H27N3O4
and a molecular weight of 361.44 g/mol. Its IUPAC name is N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| PubChem CID | 24791723 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | COc1cc(CN2CCNC(=O)C2CC(=O)NC2CCC2)cc(OC)c1 |
| InChI | InChI=1S/C19H27N3O4/c1-25-15-8-13(9-16(10-15)26-2)12-22-7-6-20-19(24)17(22)11-18(23)21-14-4-3-5-14/h8-10,14,17H,3-7,11-12H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | DRFKXXOHPVXGOH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide?
The IUPAC name of N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide (CID 24791723) is N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
What is the SMILES notation for N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide?
The canonical SMILES for N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide is COc1cc(CN2CCNC(=O)C2CC(=O)NC2CCC2)cc(OC)c1.
What is the InChIKey of N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide?
The InChIKey is DRFKXXOHPVXGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O4/c1-25-15-8-13(9-16(10-15)26-2)12-22-7-6-20-19(24)17(22)11-18(23)21-14-4-3-5-14/h8-10,14,17H,3-7,11-12H2,1-2H3,(H,20,24)(H,21,23).
What are the key properties of N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide?
N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide has a molecular weight of 361.44 g/mol, XLogP of 1.06, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-2-[1-[(3,5-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide is sourced from PubChem (CID 24791723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).