C15H20O5 — CID 24792166
(2S,3'R,4'S,6'R)-6'-(2-hydroxyethyl)spiro[3,4-dihydrochromene-2,2'-oxane]-3',4'-diol (PubChem CID 24792166) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2S,3'R,4'S,6'R)-6'-(2-hydroxyethyl)spiro[3,4-dihydrochromene-2,2'-oxane]-3',4'-diol.
| Compound Name | (2S,3'R,4'S,6'R)-6'-(2-hydroxyethyl)spiro[3,4-dihydrochromene-2,2'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 24792166 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2S,3'R,4'S,6'R)-6'-(2-hydroxyethyl)spiro[3,4-dihydrochromene-2,2'-oxane]-3',4'-diol |
| SMILES | OCC[C@@H]1C[C@H](O)[C@@H](O)[C@@]2(CCc3ccccc3O2)O1 |
| InChI | InChI=1S/C15H20O5/c16-8-6-11-9-12(17)14(18)15(19-11)7-5-10-3-1-2-4-13(10)20-15/h1-4,11-12,14,16-18H,5-9H2/t11-,12+,14-,15+/m1/s1 |
| InChIKey | LGEBLKYAEQEJIZ-OSRDXIQISA-N |
| XLogP | 0.60 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |