About 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide
3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide (PubChem CID 24792447) has the molecular formula C17H19N3O2
and a molecular weight of 297.36 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide |
| PubChem CID | 24792447 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NCCc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H19N3O2/c1-10-13(14-6-4-5-7-15(14)19-10)8-9-18-17(21)16-11(2)20-22-12(16)3/h4-7,19H,8-9H2,1-3H3,(H,18,21) |
| InChIKey | DIQLUTYFOIGOQX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide?
The IUPAC name of 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide (CID 24792447) is 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide is Cc1noc(C)c1C(=O)NCCc1c(C)[nH]c2ccccc12.
What is the InChIKey of 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide?
The InChIKey is DIQLUTYFOIGOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2/c1-10-13(14-6-4-5-7-15(14)19-10)8-9-18-17(21)16-11(2)20-22-12(16)3/h4-7,19H,8-9H2,1-3H3,(H,18,21).
What are the key properties of 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide?
3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide has a molecular weight of 297.36 g/mol, XLogP of 3.05, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 24792447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).