C20H44N4 — CID 24792590
(2R)-2-N-[(2S,3S)-2-(cyclopentylmethylamino)-3-methylpentyl]-1-N,6-N-dimethylhexane-1,2,6-triamine (PubChem CID 24792590) has the molecular formula C20H44N4 and a molecular weight of 340.60 g/mol. Its IUPAC name is (2R)-2-N-[(2S,3S)-2-(cyclopentylmethylamino)-3-methylpentyl]-1-N,6-N-dimethylhexane-1,2,6-triamine.
| Compound Name | (2R)-2-N-[(2S,3S)-2-(cyclopentylmethylamino)-3-methylpentyl]-1-N,6-N-dimethylhexane-1,2,6-triamine |
|---|---|
| PubChem CID | 24792590 |
| Molecular Formula | C20H44N4 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.36 |
| IUPAC Name | (2R)-2-N-[(2S,3S)-2-(cyclopentylmethylamino)-3-methylpentyl]-1-N,6-N-dimethylhexane-1,2,6-triamine |
| SMILES | CC[C@H](C)[C@@H](CN[C@H](CCCCNC)CNC)NCC1CCCC1 |
| InChI | InChI=1S/C20H44N4/c1-5-17(2)20(24-14-18-10-6-7-11-18)16-23-19(15-22-4)12-8-9-13-21-3/h17-24H,5-16H2,1-4H3/t17-,19+,20+/m0/s1 |
| InChIKey | ZVZDJNHUPNVDIO-DFQSSKMNSA-N |
| XLogP | 2.75 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|