C15H11N3O2S — CID 24792913
4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]benzonitrile (PubChem CID 24792913) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]benzonitrile.
| Compound Name | 4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 24792913 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2C=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C15H11N3O2S/c16-9-12-5-7-13(8-6-12)10-18-11-17-21(19,20)15-4-2-1-3-14(15)18/h1-8,11H,10H2 |
| InChIKey | XYJWPHYVGHGPHL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |