C19H22ClNO2S — CID 24793029
(5-chlorothiophen-2-yl)-[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]methanone (PubChem CID 24793029) has the molecular formula C19H22ClNO2S and a molecular weight of 363.91 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]methanone.
| Compound Name | (5-chlorothiophen-2-yl)-[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 24793029 |
| Molecular Formula | C19H22ClNO2S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)s1)N1CCCC(CO)(CCc2ccccc2)C1 |
| InChI | InChI=1S/C19H22ClNO2S/c20-17-8-7-16(24-17)18(23)21-12-4-10-19(13-21,14-22)11-9-15-5-2-1-3-6-15/h1-3,5-8,22H,4,9-14H2 |
| InChIKey | ZEVINCXZAJKONS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |