About N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide
N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 24793150) has the molecular formula C20H29N3O4
and a molecular weight of 375.47 g/mol. Its IUPAC name is N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| PubChem CID | 24793150 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | COc1ccc(CN2CCNC(=O)C2CC(=O)NC2CCCC2)cc1OC |
| InChI | InChI=1S/C20H29N3O4/c1-26-17-8-7-14(11-18(17)27-2)13-23-10-9-21-20(25)16(23)12-19(24)22-15-5-3-4-6-15/h7-8,11,15-16H,3-6,9-10,12-13H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | WDWMRUREGOTZBW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide?
The IUPAC name of N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide (CID 24793150) is N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
What is the SMILES notation for N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide?
The canonical SMILES for N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide is COc1ccc(CN2CCNC(=O)C2CC(=O)NC2CCCC2)cc1OC.
What is the InChIKey of N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide?
The InChIKey is WDWMRUREGOTZBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O4/c1-26-17-8-7-14(11-18(17)27-2)13-23-10-9-21-20(25)16(23)12-19(24)22-15-5-3-4-6-15/h7-8,11,15-16H,3-6,9-10,12-13H2,1-2H3,(H,21,25)(H,22,24).
What are the key properties of N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide?
N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide has a molecular weight of 375.47 g/mol, XLogP of 1.45, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide is sourced from PubChem (CID 24793150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).