C21H25FN2O3 — CID 24793266
1-[2-[1-(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)piperidin-2-yl]ethyl]pyrrolidin-2-one (PubChem CID 24793266) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is 1-[2-[1-(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)piperidin-2-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[1-(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)piperidin-2-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 24793266 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[2-[1-(7-fluoro-3-methyl-1-benzofuran-2-carbonyl)piperidin-2-yl]ethyl]pyrrolidin-2-one |
| SMILES | Cc1c(C(=O)N2CCCCC2CCN2CCCC2=O)oc2c(F)cccc12 |
| InChI | InChI=1S/C21H25FN2O3/c1-14-16-7-4-8-17(22)20(16)27-19(14)21(26)24-12-3-2-6-15(24)10-13-23-11-5-9-18(23)25/h4,7-8,15H,2-3,5-6,9-13H2,1H3 |
| InChIKey | PIGFURWTRPQUDZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |