C19H26N4O2S — CID 24793357
2-[2-[2-(cyclopentylamino)-2-oxoethyl]sulfanylbenzimidazol-1-yl]-N-propan-2-ylacetamide (PubChem CID 24793357) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[2-[2-(cyclopentylamino)-2-oxoethyl]sulfanylbenzimidazol-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[2-[2-(cyclopentylamino)-2-oxoethyl]sulfanylbenzimidazol-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 24793357 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-[2-[2-(cyclopentylamino)-2-oxoethyl]sulfanylbenzimidazol-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)Cn1c(SCC(=O)NC2CCCC2)nc2ccccc21 |
| InChI | InChI=1S/C19H26N4O2S/c1-13(2)20-17(24)11-23-16-10-6-5-9-15(16)22-19(23)26-12-18(25)21-14-7-3-4-8-14/h5-6,9-10,13-14H,3-4,7-8,11-12H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | BQZHYTYZQSHRGY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |