C15H17N3O — CID 24793689
1-(2,3-dihydroindol-1-yl)-3-pyrazol-1-ylbutan-1-one (PubChem CID 24793689) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-3-pyrazol-1-ylbutan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-3-pyrazol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 24793689 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-3-pyrazol-1-ylbutan-1-one |
| SMILES | CC(CC(=O)N1CCc2ccccc21)n1cccn1 |
| InChI | InChI=1S/C15H17N3O/c1-12(18-9-4-8-16-18)11-15(19)17-10-7-13-5-2-3-6-14(13)17/h2-6,8-9,12H,7,10-11H2,1H3 |
| InChIKey | PQPIMGUGKIIHDS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |