About N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide
N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide (PubChem CID 24793758) has the molecular formula C24H36N2O2
and a molecular weight of 384.56 g/mol. Its IUPAC name is N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide |
| PubChem CID | 24793758 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide |
| SMILES | CCCCC[C@H]1CN(C2CCCCC2)C(=O)[C@@H]1CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H36N2O2/c1-2-3-6-13-20-18-26(21-14-9-5-10-15-21)24(28)22(20)16-23(27)25-17-19-11-7-4-8-12-19/h4,7-8,11-12,20-22H,2-3,5-6,9-10,13-18H2,1H3,(H,25,27)/t20-,22+/m0/s1 |
| InChIKey | CDFQQZIKYMBBBH-RBBKRZOGSA-N |
| XLogP | 4.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide?
The IUPAC name of N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide (CID 24793758) is N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide.
What is the SMILES notation for N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide?
The canonical SMILES for N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide is CCCCC[C@H]1CN(C2CCCCC2)C(=O)[C@@H]1CC(=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide?
The InChIKey is CDFQQZIKYMBBBH-RBBKRZOGSA-N. The full InChI is InChI=1S/C24H36N2O2/c1-2-3-6-13-20-18-26(21-14-9-5-10-15-21)24(28)22(20)16-23(27)25-17-19-11-7-4-8-12-19/h4,7-8,11-12,20-22H,2-3,5-6,9-10,13-18H2,1H3,(H,25,27)/t20-,22+/m0/s1.
What are the key properties of N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide?
N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide has a molecular weight of 384.56 g/mol, XLogP of 4.68, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[(3R,4R)-1-cyclohexyl-2-oxo-4-pentylpyrrolidin-3-yl]acetamide is sourced from PubChem (CID 24793758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).