C24H28N2O2 — CID 24793794
2-cyclohexyl-3-oxo-N-(2,4,6-trimethylphenyl)-1H-isoindole-4-carboxamide (PubChem CID 24793794) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-cyclohexyl-3-oxo-N-(2,4,6-trimethylphenyl)-1H-isoindole-4-carboxamide.
| Compound Name | 2-cyclohexyl-3-oxo-N-(2,4,6-trimethylphenyl)-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 24793794 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-cyclohexyl-3-oxo-N-(2,4,6-trimethylphenyl)-1H-isoindole-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cccc3c2C(=O)N(C2CCCCC2)C3)c(C)c1 |
| InChI | InChI=1S/C24H28N2O2/c1-15-12-16(2)22(17(3)13-15)25-23(27)20-11-7-8-18-14-26(24(28)21(18)20)19-9-5-4-6-10-19/h7-8,11-13,19H,4-6,9-10,14H2,1-3H3,(H,25,27) |
| InChIKey | GLZNJWSUAYYKKV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |