C20H24N4O2 — CID 24793846
1-N'-[1-(3,5-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 24793846) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-N'-[1-(3,5-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[1-(3,5-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 24793846 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-N'-[1-(3,5-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc(C)cc(-n2ncc3c2CCCC3NC(=O)C2(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C20H24N4O2/c1-12-8-13(2)10-14(9-12)24-17-5-3-4-16(15(17)11-22-24)23-19(26)20(6-7-20)18(21)25/h8-11,16H,3-7H2,1-2H3,(H2,21,25)(H,23,26) |
| InChIKey | MAUSSMRTUHBRRH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|