C18H25N3O5 — CID 24794303
3-[2-[3-(3,4-dimethoxyanilino)piperidin-1-yl]-2-oxoethyl]-1,3-oxazolidin-2-one (PubChem CID 24794303) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-[2-[3-(3,4-dimethoxyanilino)piperidin-1-yl]-2-oxoethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[3-(3,4-dimethoxyanilino)piperidin-1-yl]-2-oxoethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 24794303 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-[2-[3-(3,4-dimethoxyanilino)piperidin-1-yl]-2-oxoethyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(NC2CCCN(C(=O)CN3CCOC3=O)C2)cc1OC |
| InChI | InChI=1S/C18H25N3O5/c1-24-15-6-5-13(10-16(15)25-2)19-14-4-3-7-20(11-14)17(22)12-21-8-9-26-18(21)23/h5-6,10,14,19H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | OAUCTNDDQFKBFY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|