C23H40O6 — CID 24794367
(1S,3R,5S,7S,9R,13S,15S)-7-hydroxy-3-methoxy-13-pentyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 24794367) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (1S,3R,5S,7S,9R,13S,15S)-7-hydroxy-3-methoxy-13-pentyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1S,3R,5S,7S,9R,13S,15S)-7-hydroxy-3-methoxy-13-pentyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 24794367 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (1S,3R,5S,7S,9R,13S,15S)-7-hydroxy-3-methoxy-13-pentyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CCCCC[C@H]1C[C@@H]2CCC[C@@H](C[C@@H](OC)C[C@@H]3C[C@H](O)C[C@H](CC(=O)O1)O3)O2 |
| InChI | InChI=1S/C23H40O6/c1-3-4-5-7-19-12-17-8-6-9-18(27-17)13-20(26-2)14-21-10-16(24)11-22(28-21)15-23(25)29-19/h16-22,24H,3-15H2,1-2H3/t16-,17-,18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | ZDDVQMJQHJDDDJ-QAVTUISZSA-N |
| XLogP | 3.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|