About N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide
N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide (PubChem CID 24794412) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide |
| PubChem CID | 24794412 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide |
| SMILES | CC(CO)(CO)NC(=O)C1=CC=CC1 |
| InChI | InChI=1S/C10H15NO3/c1-10(6-12,7-13)11-9(14)8-4-2-3-5-8/h2-4,12-13H,5-7H2,1H3,(H,11,14) |
| InChIKey | UPRZJMWSKVBSJF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide?
The IUPAC name of N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide (CID 24794412) is N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide.
What is the SMILES notation for N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide?
The canonical SMILES for N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide is CC(CO)(CO)NC(=O)C1=CC=CC1.
What is the InChIKey of N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide?
The InChIKey is UPRZJMWSKVBSJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-10(6-12,7-13)11-9(14)8-4-2-3-5-8/h2-4,12-13H,5-7H2,1H3,(H,11,14).
What are the key properties of N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide?
N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide has a molecular weight of 197.23 g/mol, XLogP of -0.27, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dihydroxy-2-methylpropan-2-yl)cyclopenta-1,3-diene-1-carboxamide is sourced from PubChem (CID 24794412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).