C22H23N5O — CID 24794649
N-[(1R)-1-(2H-benzotriazol-5-yl)ethyl]-2-tert-butylquinoline-6-carboxamide (PubChem CID 24794649) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[(1R)-1-(2H-benzotriazol-5-yl)ethyl]-2-tert-butylquinoline-6-carboxamide.
| Compound Name | N-[(1R)-1-(2H-benzotriazol-5-yl)ethyl]-2-tert-butylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 24794649 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[(1R)-1-(2H-benzotriazol-5-yl)ethyl]-2-tert-butylquinoline-6-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2nc(C(C)(C)C)ccc2c1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C22H23N5O/c1-13(14-5-9-18-19(12-14)26-27-25-18)23-21(28)16-6-8-17-15(11-16)7-10-20(24-17)22(2,3)4/h5-13H,1-4H3,(H,23,28)(H,25,26,27)/t13-/m1/s1 |
| InChIKey | GJCINEDQFAAFKA-CYBMUJFWSA-N |
| XLogP | 4.29 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |