C16H13FN4O — CID 24794823
4-[5-[(4-fluorophenyl)methyl]-1H-pyrazol-3-yl]pyridine-3-carboxamide (PubChem CID 24794823) has the molecular formula C16H13FN4O and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methyl]-1H-pyrazol-3-yl]pyridine-3-carboxamide.
| Compound Name | 4-[5-[(4-fluorophenyl)methyl]-1H-pyrazol-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24794823 |
| Molecular Formula | C16H13FN4O |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methyl]-1H-pyrazol-3-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1-c1cc(Cc2ccc(F)cc2)[nH]n1 |
| InChI | InChI=1S/C16H13FN4O/c17-11-3-1-10(2-4-11)7-12-8-15(21-20-12)13-5-6-19-9-14(13)16(18)22/h1-6,8-9H,7H2,(H2,18,22)(H,20,21) |
| InChIKey | NSBIUDRVSOVMCG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |