About 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine
4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine (PubChem CID 24795043) has the molecular formula C14H17N7O
and a molecular weight of 299.34 g/mol. Its IUPAC name is 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine.
Molecular Properties
| Compound Name | 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine |
| PubChem CID | 24795043 |
| Molecular Formula | C14H17N7O |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine |
| SMILES | CCOc1nc(N)nc2ncc(-c3c(C)nn(C)c3C)nc12 |
| InChI | InChI=1S/C14H17N7O/c1-5-22-13-11-12(18-14(15)19-13)16-6-9(17-11)10-7(2)20-21(4)8(10)3/h6H,5H2,1-4H3,(H2,15,16,18,19) |
| InChIKey | BPXYJMUKHOTXBH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine?
The IUPAC name of 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine (CID 24795043) is 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine.
What is the SMILES notation for 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine?
The canonical SMILES for 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine is CCOc1nc(N)nc2ncc(-c3c(C)nn(C)c3C)nc12.
What is the InChIKey of 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine?
The InChIKey is BPXYJMUKHOTXBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N7O/c1-5-22-13-11-12(18-14(15)19-13)16-6-9(17-11)10-7(2)20-21(4)8(10)3/h6H,5H2,1-4H3,(H2,15,16,18,19).
What are the key properties of 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine?
4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine has a molecular weight of 299.34 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-6-(1,3,5-trimethylpyrazol-4-yl)pteridin-2-amine is sourced from PubChem (CID 24795043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).