About 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide
4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide (PubChem CID 24795066) has the molecular formula C24H26F2N4O2
and a molecular weight of 440.49 g/mol. Its IUPAC name is 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide |
| PubChem CID | 24795066 |
| Molecular Formula | C24H26F2N4O2 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide |
| SMILES | CCOc1cc2ncc(C(N)=O)c(Nc3ccc(F)cc3F)c2cc1C1CCN(C)CC1 |
| InChI | InChI=1S/C24H26F2N4O2/c1-3-32-22-12-21-17(11-16(22)14-6-8-30(2)9-7-14)23(18(13-28-21)24(27)31)29-20-5-4-15(25)10-19(20)26/h4-5,10-14H,3,6-9H2,1-2H3,(H2,27,31)(H,28,29) |
| InChIKey | AYGOUVZBEXIJRN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide?
The IUPAC name of 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide (CID 24795066) is 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide.
What is the SMILES notation for 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide?
The canonical SMILES for 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide is CCOc1cc2ncc(C(N)=O)c(Nc3ccc(F)cc3F)c2cc1C1CCN(C)CC1.
What is the InChIKey of 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide?
The InChIKey is AYGOUVZBEXIJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26F2N4O2/c1-3-32-22-12-21-17(11-16(22)14-6-8-30(2)9-7-14)23(18(13-28-21)24(27)31)29-20-5-4-15(25)10-19(20)26/h4-5,10-14H,3,6-9H2,1-2H3,(H2,27,31)(H,28,29).
What are the key properties of 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide?
4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide has a molecular weight of 440.49 g/mol, XLogP of 4.56, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-difluoroanilino)-7-ethoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxamide is sourced from PubChem (CID 24795066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).