About methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate
methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate (PubChem CID 24795303) has the molecular formula C15H29NO4
and a molecular weight of 287.40 g/mol. Its IUPAC name is methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate |
| PubChem CID | 24795303 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NCCC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C15H29NO4/c1-11(2)8-12(14(17)18-5)16-7-6-13-19-9-15(3,4)10-20-13/h11-13,16H,6-10H2,1-5H3/t12-/m0/s1 |
| InChIKey | SFJRJPKHVUTQNI-LBPRGKRZSA-N |
| XLogP | 1.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate?
The IUPAC name of methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate (CID 24795303) is methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate.
What is the SMILES notation for methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate?
The canonical SMILES for methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate is COC(=O)[C@H](CC(C)C)NCCC1OCC(C)(C)CO1.
What is the InChIKey of methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate?
The InChIKey is SFJRJPKHVUTQNI-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H29NO4/c1-11(2)8-12(14(17)18-5)16-7-6-13-19-9-15(3,4)10-20-13/h11-13,16H,6-10H2,1-5H3/t12-/m0/s1.
What are the key properties of methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate?
methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate has a molecular weight of 287.40 g/mol, XLogP of 1.95, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-4-methylpentanoate is sourced from PubChem (CID 24795303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).