About dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate
dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate (PubChem CID 24795427) has the molecular formula C15H27NO6
and a molecular weight of 317.38 g/mol. Its IUPAC name is dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate.
Molecular Properties
| Compound Name | dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate |
| PubChem CID | 24795427 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NCCC1OCC(C)(C)CO1)C(=O)OC |
| InChI | InChI=1S/C15H27NO6/c1-15(2)9-21-13(22-10-15)7-8-16-11(14(18)20-4)5-6-12(17)19-3/h11,13,16H,5-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | KCPPPGPRRMEDMA-NSHDSACASA-N |
| XLogP | 0.86 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate?
The IUPAC name of dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate (CID 24795427) is dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate.
What is the SMILES notation for dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate?
The canonical SMILES for dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate is COC(=O)CC[C@H](NCCC1OCC(C)(C)CO1)C(=O)OC.
What is the InChIKey of dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate?
The InChIKey is KCPPPGPRRMEDMA-NSHDSACASA-N. The full InChI is InChI=1S/C15H27NO6/c1-15(2)9-21-13(22-10-15)7-8-16-11(14(18)20-4)5-6-12(17)19-3/h11,13,16H,5-10H2,1-4H3/t11-/m0/s1.
What are the key properties of dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate?
dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate has a molecular weight of 317.38 g/mol, XLogP of 0.86, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]pentanedioate is sourced from PubChem (CID 24795427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).